C14H19F3NOY- — CID 171557878
2-ethyl-6-(trifluoromethyl)pyridine;4-methyl-3,4,5,6-tetrahydro-2H-pyran-6-ide;yttrium (PubChem CID 171557878) has the molecular formula C14H19F3NOY- and a molecular weight of 363.21 g/mol. Its IUPAC name is 2-ethyl-6-(trifluoromethyl)pyridine;4-methyl-3,4,5,6-tetrahydro-2H-pyran-6-ide;yttrium.
| Compound Name | 2-ethyl-6-(trifluoromethyl)pyridine;4-methyl-3,4,5,6-tetrahydro-2H-pyran-6-ide;yttrium |
|---|---|
| PubChem CID | 171557878 |
| Molecular Formula | C14H19F3NOY- |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 2-ethyl-6-(trifluoromethyl)pyridine;4-methyl-3,4,5,6-tetrahydro-2H-pyran-6-ide;yttrium |
| SMILES | CC1C[CH-]OCC1.CCc1cccc(C(F)(F)F)n1.[Y] |
| InChI | InChI=1S/C8H8F3N.C6H11O.Y/c1-2-6-4-3-5-7(12-6)8(9,10)11;1-6-2-4-7-5-3-6;/h3-5H,2H2,1H3;4,6H,2-3,5H2,1H3;/q;-1; |
| InChIKey | QKQIAICZFAKQQH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|