C14H14F3NO4 — CID 171557941
(2R,3R,4S,5R,6R)-6-ethynyl-2-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol (PubChem CID 171557941) has the molecular formula C14H14F3NO4 and a molecular weight of 317.26 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-6-ethynyl-2-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol.
| Compound Name | (2R,3R,4S,5R,6R)-6-ethynyl-2-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol |
|---|---|
| PubChem CID | 171557941 |
| Molecular Formula | C14H14F3NO4 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | (2R,3R,4S,5R,6R)-6-ethynyl-2-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol |
| SMILES | C#C[C@H]1O[C@H](C)[C@H](O)[C@H](O)[C@H]1Oc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H14F3NO4/c1-3-8-13(12(20)11(19)7(2)21-8)22-10-6-4-5-9(18-10)14(15,16)17/h1,4-8,11-13,19-20H,2H3/t7-,8-,11+,12+,13+/m1/s1 |
| InChIKey | QYMPCPFDZQAXOH-XYDBGHNUSA-N |
| XLogP | 0.99 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|