C24H32F3N5O6 — CID 171558016
tert-butyl 4-[4-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]triazol-1-yl]piperidine-1-carboxylate (PubChem CID 171558016) has the molecular formula C24H32F3N5O6 and a molecular weight of 543.54 g/mol. Its IUPAC name is tert-butyl 4-[4-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]triazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]triazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171558016 |
| Molecular Formula | C24H32F3N5O6 |
| Molecular Weight | 543.54 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | tert-butyl 4-[4-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]triazol-1-yl]piperidine-1-carboxylate |
| SMILES | C[C@H]1O[C@H](c2cn(C3CCN(C(=O)OC(C)(C)C)CC3)nn2)[C@H](Oc2cccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C24H32F3N5O6/c1-13-18(33)19(34)21(37-17-7-5-6-16(28-17)24(25,26)27)20(36-13)15-12-32(30-29-15)14-8-10-31(11-9-14)22(35)38-23(2,3)4/h5-7,12-14,18-21,33-34H,8-11H2,1-4H3/t13-,18+,19+,20-,21-/m1/s1 |
| InChIKey | RHOGRPHXNNTVCU-IQRXFYDRSA-N |
| XLogP | 2.89 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |