About 2-methyloxane-3,4-diol;prop-1-yne;6-(trifluoromethyl)-1H-pyridin-2-one
2-methyloxane-3,4-diol;prop-1-yne;6-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 171558097) has the molecular formula C15H20F3NO4
and a molecular weight of 335.32 g/mol. Its IUPAC name is 2-methyloxane-3,4-diol;prop-1-yne;6-(trifluoromethyl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 2-methyloxane-3,4-diol;prop-1-yne;6-(trifluoromethyl)-1H-pyridin-2-one |
| PubChem CID | 171558097 |
| Molecular Formula | C15H20F3NO4 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 2-methyloxane-3,4-diol;prop-1-yne;6-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | C#CC.CC1OCCC(O)C1O.O=c1cccc(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C6H4F3NO.C6H12O3.C3H4/c7-6(8,9)4-2-1-3-5(11)10-4;1-4-6(8)5(7)2-3-9-4;1-3-2/h1-3H,(H,10,11);4-8H,2-3H2,1H3;1H,2H3 |
| InChIKey | XWUODTOYGUPTLB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyloxane-3,4-diol;prop-1-yne;6-(trifluoromethyl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyloxane-3,4-diol;prop-1-yne;6-(trifluoromethyl)-1H-pyridin-2-one?
The IUPAC name of 2-methyloxane-3,4-diol;prop-1-yne;6-(trifluoromethyl)-1H-pyridin-2-one (CID 171558097) is 2-methyloxane-3,4-diol;prop-1-yne;6-(trifluoromethyl)-1H-pyridin-2-one.
What is the SMILES notation for 2-methyloxane-3,4-diol;prop-1-yne;6-(trifluoromethyl)-1H-pyridin-2-one?
The canonical SMILES for 2-methyloxane-3,4-diol;prop-1-yne;6-(trifluoromethyl)-1H-pyridin-2-one is C#CC.CC1OCCC(O)C1O.O=c1cccc(C(F)(F)F)[nH]1.
What is the InChIKey of 2-methyloxane-3,4-diol;prop-1-yne;6-(trifluoromethyl)-1H-pyridin-2-one?
The InChIKey is XWUODTOYGUPTLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3NO.C6H12O3.C3H4/c7-6(8,9)4-2-1-3-5(11)10-4;1-4-6(8)5(7)2-3-9-4;1-3-2/h1-3H,(H,10,11);4-8H,2-3H2,1H3;1H,2H3.
What are the key properties of 2-methyloxane-3,4-diol;prop-1-yne;6-(trifluoromethyl)-1H-pyridin-2-one?
2-methyloxane-3,4-diol;prop-1-yne;6-(trifluoromethyl)-1H-pyridin-2-one has a molecular weight of 335.32 g/mol, XLogP of 1.55, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyloxane-3,4-diol;prop-1-yne;6-(trifluoromethyl)-1H-pyridin-2-one is sourced from PubChem (CID 171558097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).