C20H18F3N3O6 — CID 171558251
methyl 6-[2-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]ethynyl]pyridazine-3-carboxylate (PubChem CID 171558251) has the molecular formula C20H18F3N3O6 and a molecular weight of 453.37 g/mol. Its IUPAC name is methyl 6-[2-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]ethynyl]pyridazine-3-carboxylate.
| Compound Name | methyl 6-[2-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]ethynyl]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 171558251 |
| Molecular Formula | C20H18F3N3O6 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | methyl 6-[2-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]ethynyl]pyridazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(C#C[C@H]2O[C@H](C)[C@H](O)[C@H](O)[C@H]2Oc2cccc(C(F)(F)F)n2)nn1 |
| InChI | InChI=1S/C20H18F3N3O6/c1-10-16(27)17(28)18(32-15-5-3-4-14(24-15)20(21,22)23)13(31-10)9-7-11-6-8-12(26-25-11)19(29)30-2/h3-6,8,10,13,16-18,27-28H,1-2H3/t10-,13-,16+,17+,18+/m1/s1 |
| InChIKey | NXMUALYMWWWCLF-DPIRZVCUSA-N |
| XLogP | 0.99 |
| TPSA | 123.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|