C18H18F3N3O7 — CID 171558265
5-[[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]methoxy]pyrazine-2-carboxylic acid (PubChem CID 171558265) has the molecular formula C18H18F3N3O7 and a molecular weight of 445.35 g/mol. Its IUPAC name is 5-[[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]methoxy]pyrazine-2-carboxylic acid.
| Compound Name | 5-[[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]methoxy]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 171558265 |
| Molecular Formula | C18H18F3N3O7 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 5-[[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]methoxy]pyrazine-2-carboxylic acid |
| SMILES | C[C@H]1O[C@H](COc2cnc(C(=O)O)cn2)[C@H](Oc2cccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H18F3N3O7/c1-8-14(25)15(26)16(31-12-4-2-3-11(24-12)18(19,20)21)10(30-8)7-29-13-6-22-9(5-23-13)17(27)28/h2-6,8,10,14-16,25-26H,7H2,1H3,(H,27,28)/t8-,10-,14+,15+,16+/m1/s1 |
| InChIKey | UYNZMNWCOXZFRJ-AQXKRNKWSA-N |
| XLogP | 0.92 |
| TPSA | 144.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |