C18H23F4N3O8 — CID 171558388
2-[2-[2-[[(2R,3R,4R,5S)-5-[[3-fluoro-6-(trifluoromethyl)-2-pyridinyl]amino]-3,4-dihydroxyoxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetic acid (PubChem CID 171558388) has the molecular formula C18H23F4N3O8 and a molecular weight of 485.39 g/mol. Its IUPAC name is 2-[2-[2-[[(2R,3R,4R,5S)-5-[[3-fluoro-6-(trifluoromethyl)-2-pyridinyl]amino]-3,4-dihydroxyoxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[[(2R,3R,4R,5S)-5-[[3-fluoro-6-(trifluoromethyl)-2-pyridinyl]amino]-3,4-dihydroxyoxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 171558388 |
| Molecular Formula | C18H23F4N3O8 |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 2-[2-[2-[[(2R,3R,4R,5S)-5-[[3-fluoro-6-(trifluoromethyl)-2-pyridinyl]amino]-3,4-dihydroxyoxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COCCOCC(=O)NC[C@H]1OC[C@H](Nc2nc(C(F)(F)F)ccc2F)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H23F4N3O8/c19-9-1-2-12(18(20,21)22)25-17(9)24-10-6-33-11(16(30)15(10)29)5-23-13(26)7-31-3-4-32-8-14(27)28/h1-2,10-11,15-16,29-30H,3-8H2,(H,23,26)(H,24,25)(H,27,28)/t10-,11+,15+,16-/m0/s1 |
| InChIKey | QFBRKEITJWKOSN-TZCMFKBTSA-N |
| XLogP | -0.63 |
| TPSA | 159.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|