C11H13F3N2O3 — CID 171558566
(3S,4S,5S)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]piperidine-3,4-diol (PubChem CID 171558566) has the molecular formula C11H13F3N2O3 and a molecular weight of 278.23 g/mol. Its IUPAC name is (3S,4S,5S)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]piperidine-3,4-diol.
| Compound Name | (3S,4S,5S)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]piperidine-3,4-diol |
|---|---|
| PubChem CID | 171558566 |
| Molecular Formula | C11H13F3N2O3 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | (3S,4S,5S)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]piperidine-3,4-diol |
| SMILES | O[C@@H]1[C@@H](Oc2cccc(C(F)(F)F)n2)CNC[C@@H]1O |
| InChI | InChI=1S/C11H13F3N2O3/c12-11(13,14)8-2-1-3-9(16-8)19-7-5-15-4-6(17)10(7)18/h1-3,6-7,10,15,17-18H,4-5H2/t6-,7-,10-/m0/s1 |
| InChIKey | VOVMXQGEBCDHNW-BYULHYEWSA-N |
| XLogP | 0.17 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |