C13H17F3N4O2 — CID 171558573
(3aS,7S,7aR)-2,2-dimethyl-N-[4-(trifluoromethyl)pyrimidin-2-yl]-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-7-amine (PubChem CID 171558573) has the molecular formula C13H17F3N4O2 and a molecular weight of 318.30 g/mol. Its IUPAC name is (3aS,7S,7aR)-2,2-dimethyl-N-[4-(trifluoromethyl)pyrimidin-2-yl]-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-7-amine.
| Compound Name | (3aS,7S,7aR)-2,2-dimethyl-N-[4-(trifluoromethyl)pyrimidin-2-yl]-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-7-amine |
|---|---|
| PubChem CID | 171558573 |
| Molecular Formula | C13H17F3N4O2 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (3aS,7S,7aR)-2,2-dimethyl-N-[4-(trifluoromethyl)pyrimidin-2-yl]-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-7-amine |
| SMILES | CC1(C)O[C@@H]2[C@@H](Nc3nccc(C(F)(F)F)n3)CNC[C@@H]2O1 |
| InChI | InChI=1S/C13H17F3N4O2/c1-12(2)21-8-6-17-5-7(10(8)22-12)19-11-18-4-3-9(20-11)13(14,15)16/h3-4,7-8,10,17H,5-6H2,1-2H3,(H,18,19,20)/t7-,8-,10+/m0/s1 |
| InChIKey | WEAVEBIZFQZUOL-OYNCUSHFSA-N |
| XLogP | 1.40 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |