C28H31F3N6O6 — CID 171558595
benzyl 4-[5-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methoxy]pyrazin-2-yl]piperidine-1-carboxylate (PubChem CID 171558595) has the molecular formula C28H31F3N6O6 and a molecular weight of 604.59 g/mol. Its IUPAC name is benzyl 4-[5-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methoxy]pyrazin-2-yl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[5-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methoxy]pyrazin-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171558595 |
| Molecular Formula | C28H31F3N6O6 |
| Molecular Weight | 604.59 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | benzyl 4-[5-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methoxy]pyrazin-2-yl]piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC(c2cnc(OC[C@H]3OC[C@H](Nc4cncc(C(F)(F)F)n4)[C@@H](O)[C@H]3O)cn2)CC1 |
| InChI | InChI=1S/C28H31F3N6O6/c29-28(30,31)22-11-32-12-23(36-22)35-20-15-41-21(26(39)25(20)38)16-42-24-13-33-19(10-34-24)18-6-8-37(9-7-18)27(40)43-14-17-4-2-1-3-5-17/h1-5,10-13,18,20-21,25-26,38-39H,6-9,14-16H2,(H,35,36)/t20-,21+,25+,26-/m0/s1 |
| InChIKey | ZHFLYLLOCFQIKX-MZFMZNHHSA-N |
| XLogP | 2.78 |
| TPSA | 152.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.59 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |