About 2-(hydroxymethyl)oxane-3,4-diol;2-methyl-4-(trifluoromethyl)pyrimidine
2-(hydroxymethyl)oxane-3,4-diol;2-methyl-4-(trifluoromethyl)pyrimidine (PubChem CID 171558677) has the molecular formula C12H17F3N2O4
and a molecular weight of 310.27 g/mol. Its IUPAC name is 2-(hydroxymethyl)oxane-3,4-diol;2-methyl-4-(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)oxane-3,4-diol;2-methyl-4-(trifluoromethyl)pyrimidine |
| PubChem CID | 171558677 |
| Molecular Formula | C12H17F3N2O4 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-(hydroxymethyl)oxane-3,4-diol;2-methyl-4-(trifluoromethyl)pyrimidine |
| SMILES | Cc1nccc(C(F)(F)F)n1.OCC1OCCC(O)C1O |
| InChI | InChI=1S/C6H5F3N2.C6H12O4/c1-4-10-3-2-5(11-4)6(7,8)9;7-3-5-6(9)4(8)1-2-10-5/h2-3H,1H3;4-9H,1-3H2 |
| InChIKey | IKFUBESWURAQLS-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(hydroxymethyl)oxane-3,4-diol;2-methyl-4-(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)oxane-3,4-diol;2-methyl-4-(trifluoromethyl)pyrimidine?
The IUPAC name of 2-(hydroxymethyl)oxane-3,4-diol;2-methyl-4-(trifluoromethyl)pyrimidine (CID 171558677) is 2-(hydroxymethyl)oxane-3,4-diol;2-methyl-4-(trifluoromethyl)pyrimidine.
What is the SMILES notation for 2-(hydroxymethyl)oxane-3,4-diol;2-methyl-4-(trifluoromethyl)pyrimidine?
The canonical SMILES for 2-(hydroxymethyl)oxane-3,4-diol;2-methyl-4-(trifluoromethyl)pyrimidine is Cc1nccc(C(F)(F)F)n1.OCC1OCCC(O)C1O.
What is the InChIKey of 2-(hydroxymethyl)oxane-3,4-diol;2-methyl-4-(trifluoromethyl)pyrimidine?
The InChIKey is IKFUBESWURAQLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F3N2.C6H12O4/c1-4-10-3-2-5(11-4)6(7,8)9;7-3-5-6(9)4(8)1-2-10-5/h2-3H,1H3;4-9H,1-3H2.
What are the key properties of 2-(hydroxymethyl)oxane-3,4-diol;2-methyl-4-(trifluoromethyl)pyrimidine?
2-(hydroxymethyl)oxane-3,4-diol;2-methyl-4-(trifluoromethyl)pyrimidine has a molecular weight of 310.27 g/mol, XLogP of 0.29, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)oxane-3,4-diol;2-methyl-4-(trifluoromethyl)pyrimidine is sourced from PubChem (CID 171558677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).