C22H30F3N7O5 — CID 171558736
tert-butyl 4-[4-[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]triazol-1-yl]piperidine-1-carboxylate (PubChem CID 171558736) has the molecular formula C22H30F3N7O5 and a molecular weight of 529.52 g/mol. Its IUPAC name is tert-butyl 4-[4-[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]triazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]triazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171558736 |
| Molecular Formula | C22H30F3N7O5 |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | tert-butyl 4-[4-[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]triazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc([C@H]3OC[C@H](Nc4cncc(C(F)(F)F)n4)[C@@H](O)[C@H]3O)nn2)CC1 |
| InChI | InChI=1S/C22H30F3N7O5/c1-21(2,3)37-20(35)31-6-4-12(5-7-31)32-10-13(29-30-32)19-18(34)17(33)14(11-36-19)27-16-9-26-8-15(28-16)22(23,24)25/h8-10,12,14,17-19,33-34H,4-7,11H2,1-3H3,(H,27,28)/t14-,17+,18+,19+/m0/s1 |
| InChIKey | LRBLTZIZBWBENK-JEDBISTDSA-N |
| XLogP | 1.93 |
| TPSA | 147.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |