C11H12F3NO3S — CID 171558869
(3R,4S,5R)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]thiane-3,4-diol (PubChem CID 171558869) has the molecular formula C11H12F3NO3S and a molecular weight of 295.28 g/mol. Its IUPAC name is (3R,4S,5R)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]thiane-3,4-diol.
| Compound Name | (3R,4S,5R)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]thiane-3,4-diol |
|---|---|
| PubChem CID | 171558869 |
| Molecular Formula | C11H12F3NO3S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | (3R,4S,5R)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]thiane-3,4-diol |
| SMILES | O[C@@H]1[C@@H](Oc2cccc(C(F)(F)F)n2)CSC[C@@H]1O |
| InChI | InChI=1S/C11H12F3NO3S/c12-11(13,14)8-2-1-3-9(15-8)18-7-5-19-4-6(16)10(7)17/h1-3,6-7,10,16-17H,4-5H2/t6-,7-,10-/m0/s1 |
| InChIKey | WAHILBQPLWVEOU-BYULHYEWSA-N |
| XLogP | 1.32 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |