C22H25F3N4O5 — CID 171558883
N-[(1S,2R,8R,9R,10S)-4,4-dimethyl-1-(pyrazin-2-yloxymethyl)-3,5,11,13-tetraoxatricyclo[8.2.1.02,8]tridecan-9-yl]-6-(trifluoromethyl)pyridin-2-amine (PubChem CID 171558883) has the molecular formula C22H25F3N4O5 and a molecular weight of 482.46 g/mol. Its IUPAC name is N-[(1S,2R,8R,9R,10S)-4,4-dimethyl-1-(pyrazin-2-yloxymethyl)-3,5,11,13-tetraoxatricyclo[8.2.1.02,8]tridecan-9-yl]-6-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(1S,2R,8R,9R,10S)-4,4-dimethyl-1-(pyrazin-2-yloxymethyl)-3,5,11,13-tetraoxatricyclo[8.2.1.02,8]tridecan-9-yl]-6-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 171558883 |
| Molecular Formula | C22H25F3N4O5 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | N-[(1S,2R,8R,9R,10S)-4,4-dimethyl-1-(pyrazin-2-yloxymethyl)-3,5,11,13-tetraoxatricyclo[8.2.1.02,8]tridecan-9-yl]-6-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC1(C)OCC[C@@H]2[C@@H](Nc3cccc(C(F)(F)F)n3)[C@H]3OC[C@](COc4cnccn4)(O3)[C@@H]2O1 |
| InChI | InChI=1S/C22H25F3N4O5/c1-20(2)32-9-6-13-17(29-15-5-3-4-14(28-15)22(23,24)25)19-31-12-21(34-19,18(13)33-20)11-30-16-10-26-7-8-27-16/h3-5,7-8,10,13,17-19H,6,9,11-12H2,1-2H3,(H,28,29)/t13-,17-,18-,19+,21+/m1/s1 |
| InChIKey | ICICDLJWEQTCJH-UTEVZBQWSA-N |
| XLogP | 3.03 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |