About 4-(2-methylpropyl)piperazine-1-carbaldehyde;pentanehydrazide
4-(2-methylpropyl)piperazine-1-carbaldehyde;pentanehydrazide (PubChem CID 171559201) has the molecular formula C14H30N4O2
and a molecular weight of 286.42 g/mol. Its IUPAC name is 4-(2-methylpropyl)piperazine-1-carbaldehyde;pentanehydrazide.
Molecular Properties
| Compound Name | 4-(2-methylpropyl)piperazine-1-carbaldehyde;pentanehydrazide |
| PubChem CID | 171559201 |
| Molecular Formula | C14H30N4O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 4-(2-methylpropyl)piperazine-1-carbaldehyde;pentanehydrazide |
| SMILES | CC(C)CN1CCN(C=O)CC1.CCCCC(=O)NN |
| InChI | InChI=1S/C9H18N2O.C5H12N2O/c1-9(2)7-10-3-5-11(8-12)6-4-10;1-2-3-4-5(8)7-6/h8-9H,3-7H2,1-2H3;2-4,6H2,1H3,(H,7,8) |
| InChIKey | XBBTUSSBOHKASC-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methylpropyl)piperazine-1-carbaldehyde;pentanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylpropyl)piperazine-1-carbaldehyde;pentanehydrazide?
The IUPAC name of 4-(2-methylpropyl)piperazine-1-carbaldehyde;pentanehydrazide (CID 171559201) is 4-(2-methylpropyl)piperazine-1-carbaldehyde;pentanehydrazide.
What is the SMILES notation for 4-(2-methylpropyl)piperazine-1-carbaldehyde;pentanehydrazide?
The canonical SMILES for 4-(2-methylpropyl)piperazine-1-carbaldehyde;pentanehydrazide is CC(C)CN1CCN(C=O)CC1.CCCCC(=O)NN.
What is the InChIKey of 4-(2-methylpropyl)piperazine-1-carbaldehyde;pentanehydrazide?
The InChIKey is XBBTUSSBOHKASC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O.C5H12N2O/c1-9(2)7-10-3-5-11(8-12)6-4-10;1-2-3-4-5(8)7-6/h8-9H,3-7H2,1-2H3;2-4,6H2,1H3,(H,7,8).
What are the key properties of 4-(2-methylpropyl)piperazine-1-carbaldehyde;pentanehydrazide?
4-(2-methylpropyl)piperazine-1-carbaldehyde;pentanehydrazide has a molecular weight of 286.42 g/mol, XLogP of 0.58, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylpropyl)piperazine-1-carbaldehyde;pentanehydrazide is sourced from PubChem (CID 171559201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).