C33H40ClN5O6 — CID 171560464
5-chloro-3-[3,4-dimethyl-1-[5-[(4-pyrrolidin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-yl)methoxy]pentanoyl]piperidin-4-yl]-1H-pyridin-2-one;formic acid (PubChem CID 171560464) has the molecular formula C33H40ClN5O6 and a molecular weight of 638.17 g/mol. Its IUPAC name is 5-chloro-3-[3,4-dimethyl-1-[5-[(4-pyrrolidin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-yl)methoxy]pentanoyl]piperidin-4-yl]-1H-pyridin-2-one;formic acid.
| Compound Name | 5-chloro-3-[3,4-dimethyl-1-[5-[(4-pyrrolidin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-yl)methoxy]pentanoyl]piperidin-4-yl]-1H-pyridin-2-one;formic acid |
|---|---|
| PubChem CID | 171560464 |
| Molecular Formula | C33H40ClN5O6 |
| Molecular Weight | 638.17 g/mol |
| Exact Mass | 637.27 |
| IUPAC Name | 5-chloro-3-[3,4-dimethyl-1-[5-[(4-pyrrolidin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-yl)methoxy]pentanoyl]piperidin-4-yl]-1H-pyridin-2-one;formic acid |
| SMILES | CC1CN(C(=O)CCCCOCc2nc(N3CCCC3)c3oc4ccccc4c3n2)CCC1(C)c1cc(Cl)c[nH]c1=O.O=CO |
| InChI | InChI=1S/C32H38ClN5O4.CH2O2/c1-21-19-38(15-12-32(21,2)24-17-22(33)18-34-31(24)40)27(39)11-5-8-16-41-20-26-35-28-23-9-3-4-10-25(23)42-29(28)30(36-26)37-13-6-7-14-37;2-1-3/h3-4,9-10,17-18,21H,5-8,11-16,19-20H2,1-2H3,(H,34,40);1H,(H,2,3) |
| InChIKey | GXRYIUZJWUFWCX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 141.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.17 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|