About [butanoyl(formyl)amino] 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate
[butanoyl(formyl)amino] 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate (PubChem CID 171560937) has the molecular formula C13H18N2O6
and a molecular weight of 298.29 g/mol. Its IUPAC name is [butanoyl(formyl)amino] 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate.
Molecular Properties
| Compound Name | [butanoyl(formyl)amino] 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate |
| PubChem CID | 171560937 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | [butanoyl(formyl)amino] 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate |
| SMILES | CCCC(=O)N(C=O)OC(=O)CCN(C)C(=O)/C=C\C=O |
| InChI | InChI=1S/C13H18N2O6/c1-3-5-12(19)15(10-17)21-13(20)7-8-14(2)11(18)6-4-9-16/h4,6,9-10H,3,5,7-8H2,1-2H3/b6-4- |
| InChIKey | KTLRFBCILGZLLL-XQRVVYSFSA-N |
| XLogP | -0.17 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [butanoyl(formyl)amino] 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [butanoyl(formyl)amino] 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate?
The IUPAC name of [butanoyl(formyl)amino] 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate (CID 171560937) is [butanoyl(formyl)amino] 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate.
What is the SMILES notation for [butanoyl(formyl)amino] 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate?
The canonical SMILES for [butanoyl(formyl)amino] 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate is CCCC(=O)N(C=O)OC(=O)CCN(C)C(=O)/C=C\C=O.
What is the InChIKey of [butanoyl(formyl)amino] 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate?
The InChIKey is KTLRFBCILGZLLL-XQRVVYSFSA-N. The full InChI is InChI=1S/C13H18N2O6/c1-3-5-12(19)15(10-17)21-13(20)7-8-14(2)11(18)6-4-9-16/h4,6,9-10H,3,5,7-8H2,1-2H3/b6-4-.
What are the key properties of [butanoyl(formyl)amino] 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate?
[butanoyl(formyl)amino] 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate has a molecular weight of 298.29 g/mol, XLogP of -0.17, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [butanoyl(formyl)amino] 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate is sourced from PubChem (CID 171560937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).