C24H50O3Si2 — CID 171561786
triethyl-[(2S,3S)-2-[(2R,3R)-3-[(2R)-2-methyl-2-triethylsilyloxybut-3-enyl]oxiran-2-yl]pentan-3-yl]oxysilane (PubChem CID 171561786) has the molecular formula C24H50O3Si2 and a molecular weight of 442.83 g/mol. Its IUPAC name is triethyl-[(2S,3S)-2-[(2R,3R)-3-[(2R)-2-methyl-2-triethylsilyloxybut-3-enyl]oxiran-2-yl]pentan-3-yl]oxysilane.
| Compound Name | triethyl-[(2S,3S)-2-[(2R,3R)-3-[(2R)-2-methyl-2-triethylsilyloxybut-3-enyl]oxiran-2-yl]pentan-3-yl]oxysilane |
|---|---|
| PubChem CID | 171561786 |
| Molecular Formula | C24H50O3Si2 |
| Molecular Weight | 442.83 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | triethyl-[(2S,3S)-2-[(2R,3R)-3-[(2R)-2-methyl-2-triethylsilyloxybut-3-enyl]oxiran-2-yl]pentan-3-yl]oxysilane |
| SMILES | C=C[C@@](C)(C[C@H]1O[C@@H]1[C@H](C)[C@H](CC)O[Si](CC)(CC)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H50O3Si2/c1-11-21(26-28(13-3,14-4)15-5)20(9)23-22(25-23)19-24(10,12-2)27-29(16-6,17-7)18-8/h12,20-23H,2,11,13-19H2,1,3-10H3/t20-,21+,22-,23-,24+/m1/s1 |
| InChIKey | DGTPBMBOUDOFGE-HUUMMWPTSA-N |
| XLogP | 7.55 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.83 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|