About 9-[4-(3-chloro-4-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]carbazole
9-[4-(3-chloro-4-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]carbazole (PubChem CID 171562310) has the molecular formula C27H16ClFN4
and a molecular weight of 450.90 g/mol. Its IUPAC name is 9-[4-(3-chloro-4-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]carbazole.
Molecular Properties
| Compound Name | 9-[4-(3-chloro-4-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]carbazole |
| PubChem CID | 171562310 |
| Molecular Formula | C27H16ClFN4 |
| Molecular Weight | 450.90 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 9-[4-(3-chloro-4-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]carbazole |
| SMILES | Fc1ccc(-c2nc(-c3ccccc3)nc(-n3c4ccccc4c4ccccc43)n2)cc1Cl |
| InChI | InChI=1S/C27H16ClFN4/c28-21-16-18(14-15-22(21)29)26-30-25(17-8-2-1-3-9-17)31-27(32-26)33-23-12-6-4-10-19(23)20-11-5-7-13-24(20)33/h1-16H |
| InChIKey | UTUFDRDYDZUVSH-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.90 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-[4-(3-chloro-4-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[4-(3-chloro-4-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]carbazole?
The IUPAC name of 9-[4-(3-chloro-4-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]carbazole (CID 171562310) is 9-[4-(3-chloro-4-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]carbazole.
What is the SMILES notation for 9-[4-(3-chloro-4-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]carbazole?
The canonical SMILES for 9-[4-(3-chloro-4-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]carbazole is Fc1ccc(-c2nc(-c3ccccc3)nc(-n3c4ccccc4c4ccccc43)n2)cc1Cl.
What is the InChIKey of 9-[4-(3-chloro-4-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]carbazole?
The InChIKey is UTUFDRDYDZUVSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H16ClFN4/c28-21-16-18(14-15-22(21)29)26-30-25(17-8-2-1-3-9-17)31-27(32-26)33-23-12-6-4-10-19(23)20-11-5-7-13-24(20)33/h1-16H.
What are the key properties of 9-[4-(3-chloro-4-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]carbazole?
9-[4-(3-chloro-4-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]carbazole has a molecular weight of 450.90 g/mol, XLogP of 7.10, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[4-(3-chloro-4-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]carbazole is sourced from PubChem (CID 171562310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).