About 2-(dimethylamino)ethanol;ethane;4-[methyl(propyl)amino]butan-1-ol
2-(dimethylamino)ethanol;ethane;4-[methyl(propyl)amino]butan-1-ol (PubChem CID 171562694) has the molecular formula C14H36N2O2
and a molecular weight of 264.45 g/mol. Its IUPAC name is 2-(dimethylamino)ethanol;ethane;4-[methyl(propyl)amino]butan-1-ol.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethanol;ethane;4-[methyl(propyl)amino]butan-1-ol |
| PubChem CID | 171562694 |
| Molecular Formula | C14H36N2O2 |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.28 |
| IUPAC Name | 2-(dimethylamino)ethanol;ethane;4-[methyl(propyl)amino]butan-1-ol |
| SMILES | CC.CCCN(C)CCCCO.CN(C)CCO |
| InChI | InChI=1S/C8H19NO.C4H11NO.C2H6/c1-3-6-9(2)7-4-5-8-10;1-5(2)3-4-6;1-2/h10H,3-8H2,1-2H3;6H,3-4H2,1-2H3;1-2H3 |
| InChIKey | QZBZTPZHURHLFZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethanol;ethane;4-[methyl(propyl)amino]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethanol;ethane;4-[methyl(propyl)amino]butan-1-ol?
The IUPAC name of 2-(dimethylamino)ethanol;ethane;4-[methyl(propyl)amino]butan-1-ol (CID 171562694) is 2-(dimethylamino)ethanol;ethane;4-[methyl(propyl)amino]butan-1-ol.
What is the SMILES notation for 2-(dimethylamino)ethanol;ethane;4-[methyl(propyl)amino]butan-1-ol?
The canonical SMILES for 2-(dimethylamino)ethanol;ethane;4-[methyl(propyl)amino]butan-1-ol is CC.CCCN(C)CCCCO.CN(C)CCO.
What is the InChIKey of 2-(dimethylamino)ethanol;ethane;4-[methyl(propyl)amino]butan-1-ol?
The InChIKey is QZBZTPZHURHLFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO.C4H11NO.C2H6/c1-3-6-9(2)7-4-5-8-10;1-5(2)3-4-6;1-2/h10H,3-8H2,1-2H3;6H,3-4H2,1-2H3;1-2H3.
What are the key properties of 2-(dimethylamino)ethanol;ethane;4-[methyl(propyl)amino]butan-1-ol?
2-(dimethylamino)ethanol;ethane;4-[methyl(propyl)amino]butan-1-ol has a molecular weight of 264.45 g/mol, XLogP of 1.67, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethanol;ethane;4-[methyl(propyl)amino]butan-1-ol is sourced from PubChem (CID 171562694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).