C19H31N3O3 — CID 171562959
4-ethyl-1,2-dimethoxybenzene;2-(2-methylanilino)acetohydrazide;molecular hydrogen (PubChem CID 171562959) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is 4-ethyl-1,2-dimethoxybenzene;2-(2-methylanilino)acetohydrazide;molecular hydrogen.
| Compound Name | 4-ethyl-1,2-dimethoxybenzene;2-(2-methylanilino)acetohydrazide;molecular hydrogen |
|---|---|
| PubChem CID | 171562959 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 4-ethyl-1,2-dimethoxybenzene;2-(2-methylanilino)acetohydrazide;molecular hydrogen |
| SMILES | CCc1ccc(OC)c(OC)c1.Cc1ccccc1NCC(=O)NN.[H][H].[H][H] |
| InChI | InChI=1S/C10H14O2.C9H13N3O.2H2/c1-4-8-5-6-9(11-2)10(7-8)12-3;1-7-4-2-3-5-8(7)11-6-9(13)12-10;;/h5-7H,4H2,1-3H3;2-5,11H,6,10H2,1H3,(H,12,13);2*1H |
| InChIKey | ZSNJZQJYCFIUEY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|