C33H33N7O2 — CID 171563146
(E)-N-[1-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]piperidin-4-yl]-3-methoxyprop-2-enamide (PubChem CID 171563146) has the molecular formula C33H33N7O2 and a molecular weight of 559.67 g/mol. Its IUPAC name is (E)-N-[1-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]piperidin-4-yl]-3-methoxyprop-2-enamide.
| Compound Name | (E)-N-[1-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]piperidin-4-yl]-3-methoxyprop-2-enamide |
|---|---|
| PubChem CID | 171563146 |
| Molecular Formula | C33H33N7O2 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | (E)-N-[1-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]piperidin-4-yl]-3-methoxyprop-2-enamide |
| SMILES | CO/C=C/C(=O)NC1CCN(Cc2ccc(-n3c(-c4cccnc4N)nc4ccc(-c5ccccc5)nc43)cc2)CC1 |
| InChI | InChI=1S/C33H33N7O2/c1-42-21-17-30(41)36-25-15-19-39(20-16-25)22-23-9-11-26(12-10-23)40-32(27-8-5-18-35-31(27)34)38-29-14-13-28(37-33(29)40)24-6-3-2-4-7-24/h2-14,17-18,21,25H,15-16,19-20,22H2,1H3,(H2,34,35)(H,36,41)/b21-17+ |
| InChIKey | BJUOCVWWPNSASQ-HEHNFIMWSA-N |
| XLogP | 4.97 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|