About acetamide;(Z)-N-methyl-1-[(Z)-prop-2-enylideneamino]prop-1-en-1-amine
acetamide;(Z)-N-methyl-1-[(Z)-prop-2-enylideneamino]prop-1-en-1-amine (PubChem CID 171563166) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is acetamide;(Z)-N-methyl-1-[(Z)-prop-2-enylideneamino]prop-1-en-1-amine.
Molecular Properties
| Compound Name | acetamide;(Z)-N-methyl-1-[(Z)-prop-2-enylideneamino]prop-1-en-1-amine |
| PubChem CID | 171563166 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | acetamide;(Z)-N-methyl-1-[(Z)-prop-2-enylideneamino]prop-1-en-1-amine |
| SMILES | C=C/C=N\C(=C/C)NC.CC(N)=O |
| InChI | InChI=1S/C7H12N2.C2H5NO/c1-4-6-9-7(5-2)8-3;1-2(3)4/h4-6,8H,1H2,2-3H3;1H3,(H2,3,4)/b7-5-,9-6-; |
| InChIKey | CKBOGCZMPXTFSU-ORYMYBSFSA-N |
| XLogP | 0.82 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze acetamide;(Z)-N-methyl-1-[(Z)-prop-2-enylideneamino]prop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;(Z)-N-methyl-1-[(Z)-prop-2-enylideneamino]prop-1-en-1-amine?
The IUPAC name of acetamide;(Z)-N-methyl-1-[(Z)-prop-2-enylideneamino]prop-1-en-1-amine (CID 171563166) is acetamide;(Z)-N-methyl-1-[(Z)-prop-2-enylideneamino]prop-1-en-1-amine.
What is the SMILES notation for acetamide;(Z)-N-methyl-1-[(Z)-prop-2-enylideneamino]prop-1-en-1-amine?
The canonical SMILES for acetamide;(Z)-N-methyl-1-[(Z)-prop-2-enylideneamino]prop-1-en-1-amine is C=C/C=N\C(=C/C)NC.CC(N)=O.
What is the InChIKey of acetamide;(Z)-N-methyl-1-[(Z)-prop-2-enylideneamino]prop-1-en-1-amine?
The InChIKey is CKBOGCZMPXTFSU-ORYMYBSFSA-N. The full InChI is InChI=1S/C7H12N2.C2H5NO/c1-4-6-9-7(5-2)8-3;1-2(3)4/h4-6,8H,1H2,2-3H3;1H3,(H2,3,4)/b7-5-,9-6-;.
What are the key properties of acetamide;(Z)-N-methyl-1-[(Z)-prop-2-enylideneamino]prop-1-en-1-amine?
acetamide;(Z)-N-methyl-1-[(Z)-prop-2-enylideneamino]prop-1-en-1-amine has a molecular weight of 183.25 g/mol, XLogP of 0.82, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;(Z)-N-methyl-1-[(Z)-prop-2-enylideneamino]prop-1-en-1-amine is sourced from PubChem (CID 171563166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).