C24H35N5O3 — CID 171564437
tert-butyl 3-azabicyclo[3.1.1]heptane-3-carboxylate;N-[2-(1-cyclopropylimidazo[1,5-a]pyridin-3-yl)propan-2-yl]nitrous amide (PubChem CID 171564437) has the molecular formula C24H35N5O3 and a molecular weight of 441.58 g/mol. Its IUPAC name is tert-butyl 3-azabicyclo[3.1.1]heptane-3-carboxylate;N-[2-(1-cyclopropylimidazo[1,5-a]pyridin-3-yl)propan-2-yl]nitrous amide.
| Compound Name | tert-butyl 3-azabicyclo[3.1.1]heptane-3-carboxylate;N-[2-(1-cyclopropylimidazo[1,5-a]pyridin-3-yl)propan-2-yl]nitrous amide |
|---|---|
| PubChem CID | 171564437 |
| Molecular Formula | C24H35N5O3 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | tert-butyl 3-azabicyclo[3.1.1]heptane-3-carboxylate;N-[2-(1-cyclopropylimidazo[1,5-a]pyridin-3-yl)propan-2-yl]nitrous amide |
| SMILES | CC(C)(C)OC(=O)N1CC2CC(C2)C1.CC(C)(NN=O)c1nc(C2CC2)c2ccccn12 |
| InChI | InChI=1S/C13H16N4O.C11H19NO2/c1-13(2,15-16-18)12-14-11(9-6-7-9)10-5-3-4-8-17(10)12;1-11(2,3)14-10(13)12-6-8-4-9(5-8)7-12/h3-5,8-9H,6-7H2,1-2H3,(H,15,18);8-9H,4-7H2,1-3H3 |
| InChIKey | MNYTXKYPLAZXGQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 88.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|