C16H17N5O — CID 171564502
ethane;2-[6-(5-methyl-2-pyridinyl)-1,2,4,5-tetrazin-3-yl]phenol (PubChem CID 171564502) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is ethane;2-[6-(5-methyl-2-pyridinyl)-1,2,4,5-tetrazin-3-yl]phenol.
| Compound Name | ethane;2-[6-(5-methyl-2-pyridinyl)-1,2,4,5-tetrazin-3-yl]phenol |
|---|---|
| PubChem CID | 171564502 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | ethane;2-[6-(5-methyl-2-pyridinyl)-1,2,4,5-tetrazin-3-yl]phenol |
| SMILES | CC.Cc1ccc(-c2nnc(-c3ccccc3O)nn2)nc1 |
| InChI | InChI=1S/C14H11N5O.C2H6/c1-9-6-7-11(15-8-9)14-18-16-13(17-19-14)10-4-2-3-5-12(10)20;1-2/h2-8,20H,1H3;1-2H3 |
| InChIKey | ARWAVEPRNWUGHN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 84.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |