C9H14N4O2 — CID 171565065
1-(1,2-dimethyl-3H-pyrazol-4-yl)-1,3-diazinane-2,4-dione (PubChem CID 171565065) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 1-(1,2-dimethyl-3H-pyrazol-4-yl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(1,2-dimethyl-3H-pyrazol-4-yl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 171565065 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 1-(1,2-dimethyl-3H-pyrazol-4-yl)-1,3-diazinane-2,4-dione |
| SMILES | CN1C=C(N2CCC(=O)NC2=O)CN1C |
| InChI | InChI=1S/C9H14N4O2/c1-11-5-7(6-12(11)2)13-4-3-8(14)10-9(13)15/h5H,3-4,6H2,1-2H3,(H,10,14,15) |
| InChIKey | GXYBGUMIHHEFFK-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |