C13H13IN2OS — CID 171565074
(5R)-3-(4-iodo-1,3-benzothiazol-2-yl)-8-oxa-3-azabicyclo[3.2.1]octane (PubChem CID 171565074) has the molecular formula C13H13IN2OS and a molecular weight of 372.23 g/mol. Its IUPAC name is (5R)-3-(4-iodo-1,3-benzothiazol-2-yl)-8-oxa-3-azabicyclo[3.2.1]octane.
| Compound Name | (5R)-3-(4-iodo-1,3-benzothiazol-2-yl)-8-oxa-3-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 171565074 |
| Molecular Formula | C13H13IN2OS |
| Molecular Weight | 372.23 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | (5R)-3-(4-iodo-1,3-benzothiazol-2-yl)-8-oxa-3-azabicyclo[3.2.1]octane |
| SMILES | Ic1cccc2sc(N3CC4CC[C@H](C3)O4)nc12 |
| InChI | InChI=1S/C13H13IN2OS/c14-10-2-1-3-11-12(10)15-13(18-11)16-6-8-4-5-9(7-16)17-8/h1-3,8-9H,4-7H2/t8-,9?/m1/s1 |
| InChIKey | ROWHHTDNGGBJBA-VEDVMXKPSA-N |
| XLogP | 3.27 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|