C7H10N4O2 — CID 171565302
1-(2,3-dihydro-1H-pyrazol-4-yl)-1,3-diazinane-2,4-dione (PubChem CID 171565302) has the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-pyrazol-4-yl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(2,3-dihydro-1H-pyrazol-4-yl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 171565302 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 1-(2,3-dihydro-1H-pyrazol-4-yl)-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(C2=CNNC2)C(=O)N1 |
| InChI | InChI=1S/C7H10N4O2/c12-6-1-2-11(7(13)10-6)5-3-8-9-4-5/h3,8-9H,1-2,4H2,(H,10,12,13) |
| InChIKey | ZJLBOPZXMDTXKO-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |