C19H23NO2 — CID 17156616
N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-1-phenylbutan-1-amine (PubChem CID 17156616) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-1-phenylbutan-1-amine.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-1-phenylbutan-1-amine |
|---|---|
| PubChem CID | 17156616 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-1-phenylbutan-1-amine |
| SMILES | CCCC(NCc1ccc2c(c1)OCCO2)c1ccccc1 |
| InChI | InChI=1S/C19H23NO2/c1-2-6-17(16-7-4-3-5-8-16)20-14-15-9-10-18-19(13-15)22-12-11-21-18/h3-5,7-10,13,17,20H,2,6,11-12,14H2,1H3 |
| InChIKey | YIRBBGZJQKAUTQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |