C10H8BrN3S — CID 171566693
11-bromo-2,7,12-triazatricyclo[7.4.0.02,6]trideca-1(13),6,9,11-tetraene-8-thione (PubChem CID 171566693) has the molecular formula C10H8BrN3S and a molecular weight of 282.17 g/mol. Its IUPAC name is 11-bromo-2,7,12-triazatricyclo[7.4.0.02,6]trideca-1(13),6,9,11-tetraene-8-thione.
| Compound Name | 11-bromo-2,7,12-triazatricyclo[7.4.0.02,6]trideca-1(13),6,9,11-tetraene-8-thione |
|---|---|
| PubChem CID | 171566693 |
| Molecular Formula | C10H8BrN3S |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 280.96 |
| IUPAC Name | 11-bromo-2,7,12-triazatricyclo[7.4.0.02,6]trideca-1(13),6,9,11-tetraene-8-thione |
| SMILES | S=c1nc2n(c3cnc(Br)cc13)CCC2 |
| InChI | InChI=1S/C10H8BrN3S/c11-8-4-6-7(5-12-8)14-3-1-2-9(14)13-10(6)15/h4-5H,1-3H2 |
| InChIKey | QTPLTMAKZQQUCN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|