C26H38N2O7 — CID 171566867
8-[2-[1-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-4-yl]oxyoctanoic acid;2-methylpropane (PubChem CID 171566867) has the molecular formula C26H38N2O7 and a molecular weight of 490.60 g/mol. Its IUPAC name is 8-[2-[1-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-4-yl]oxyoctanoic acid;2-methylpropane.
| Compound Name | 8-[2-[1-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-4-yl]oxyoctanoic acid;2-methylpropane |
|---|---|
| PubChem CID | 171566867 |
| Molecular Formula | C26H38N2O7 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 8-[2-[1-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-4-yl]oxyoctanoic acid;2-methylpropane |
| SMILES | CC(C)C.CNC(=O)C(CCC=O)N1C(=O)c2cccc(OCCCCCCCC(=O)O)c2C1=O |
| InChI | InChI=1S/C22H28N2O7.C4H10/c1-23-20(28)16(10-8-13-25)24-21(29)15-9-7-11-17(19(15)22(24)30)31-14-6-4-2-3-5-12-18(26)27;1-4(2)3/h7,9,11,13,16H,2-6,8,10,12,14H2,1H3,(H,23,28)(H,26,27);4H,1-3H3 |
| InChIKey | UACXMLYLLNZSLP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|