About 2-[4,5-bis(ethenyl)-3-pyridinyl]acetonitrile
2-[4,5-bis(ethenyl)-3-pyridinyl]acetonitrile (PubChem CID 171567060) has the molecular formula C11H10N2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-[4,5-bis(ethenyl)-3-pyridinyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[4,5-bis(ethenyl)-3-pyridinyl]acetonitrile |
| PubChem CID | 171567060 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 2-[4,5-bis(ethenyl)-3-pyridinyl]acetonitrile |
| SMILES | C=Cc1cncc(CC#N)c1C=C |
| InChI | InChI=1S/C11H10N2/c1-3-9-7-13-8-10(5-6-12)11(9)4-2/h3-4,7-8H,1-2,5H2 |
| InChIKey | JAOQIFFEXFEWHB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4,5-bis(ethenyl)-3-pyridinyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4,5-bis(ethenyl)-3-pyridinyl]acetonitrile?
The IUPAC name of 2-[4,5-bis(ethenyl)-3-pyridinyl]acetonitrile (CID 171567060) is 2-[4,5-bis(ethenyl)-3-pyridinyl]acetonitrile.
What is the SMILES notation for 2-[4,5-bis(ethenyl)-3-pyridinyl]acetonitrile?
The canonical SMILES for 2-[4,5-bis(ethenyl)-3-pyridinyl]acetonitrile is C=Cc1cncc(CC#N)c1C=C.
What is the InChIKey of 2-[4,5-bis(ethenyl)-3-pyridinyl]acetonitrile?
The InChIKey is JAOQIFFEXFEWHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2/c1-3-9-7-13-8-10(5-6-12)11(9)4-2/h3-4,7-8H,1-2,5H2.
What are the key properties of 2-[4,5-bis(ethenyl)-3-pyridinyl]acetonitrile?
2-[4,5-bis(ethenyl)-3-pyridinyl]acetonitrile has a molecular weight of 170.21 g/mol, XLogP of 2.43, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,5-bis(ethenyl)-3-pyridinyl]acetonitrile is sourced from PubChem (CID 171567060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).