C21H32N2O3 — CID 171567516
4-[(3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]morpholine (PubChem CID 171567516) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is 4-[(3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]morpholine.
| Compound Name | 4-[(3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]morpholine |
|---|---|
| PubChem CID | 171567516 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 4-[(3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]morpholine |
| SMILES | COc1ccc([C@@]23CCC(N4CCOCC4)C[C@@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C21H32N2O3/c1-22-9-8-21(16-4-5-18(24-2)19(14-16)25-3)7-6-17(15-20(21)22)23-10-12-26-13-11-23/h4-5,14,17,20H,6-13,15H2,1-3H3/t17?,20-,21-/m0/s1 |
| InChIKey | UMMRIHMPWOBGBR-FUKGKQRISA-N |
| XLogP | 2.53 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |