C24H22ClFN4O2S — CID 171567854
10-chloro-5-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-3-phenylmethoxy-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 171567854) has the molecular formula C24H22ClFN4O2S and a molecular weight of 484.98 g/mol. Its IUPAC name is 10-chloro-5-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-3-phenylmethoxy-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 10-chloro-5-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-3-phenylmethoxy-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 171567854 |
| Molecular Formula | C24H22ClFN4O2S |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 10-chloro-5-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-3-phenylmethoxy-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | F[C@H]1CN2CCC[C@@]2(COc2nc(OCc3ccccc3)c3c(n2)sc2c(Cl)nccc23)C1 |
| InChI | InChI=1S/C24H22ClFN4O2S/c25-20-19-17(7-9-27-20)18-21(31-13-15-5-2-1-3-6-15)28-23(29-22(18)33-19)32-14-24-8-4-10-30(24)12-16(26)11-24/h1-3,5-7,9,16H,4,8,10-14H2/t16-,24+/m1/s1 |
| InChIKey | JASZHAQLBUUKRB-GYCJOSAFSA-N |
| XLogP | 5.43 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|