C9H13N3O2 — CID 171568572
2,6-dimethyl-3,5,7,8-tetrahydropyrimido[5,4-f][1,4]oxazepin-4-one (PubChem CID 171568572) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 2,6-dimethyl-3,5,7,8-tetrahydropyrimido[5,4-f][1,4]oxazepin-4-one.
| Compound Name | 2,6-dimethyl-3,5,7,8-tetrahydropyrimido[5,4-f][1,4]oxazepin-4-one |
|---|---|
| PubChem CID | 171568572 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 2,6-dimethyl-3,5,7,8-tetrahydropyrimido[5,4-f][1,4]oxazepin-4-one |
| SMILES | Cc1nc2c(c(=O)[nH]1)CN(C)CCO2 |
| InChI | InChI=1S/C9H13N3O2/c1-6-10-8(13)7-5-12(2)3-4-14-9(7)11-6/h3-5H2,1-2H3,(H,10,11,13) |
| InChIKey | BBWZNIDAXDUQLC-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |