C31H36ClN4O3S+ — CID 171568592
7-[5-chloro-2-[3-[6-[cyclopropyl(methyl)amino]-2-methyl-4-oxo-5,6,7,8-tetrahydroquinazolin-3-yl]prop-1-ynyl]phenyl]-4-methyl-2,3,5,6,7,7a-hexahydrothieno[3,2-b]pyridin-4-ium-3-carboxylic acid (PubChem CID 171568592) has the molecular formula C31H36ClN4O3S+ and a molecular weight of 580.17 g/mol. Its IUPAC name is 7-[5-chloro-2-[3-[6-[cyclopropyl(methyl)amino]-2-methyl-4-oxo-5,6,7,8-tetrahydroquinazolin-3-yl]prop-1-ynyl]phenyl]-4-methyl-2,3,5,6,7,7a-hexahydrothieno[3,2-b]pyridin-4-ium-3-carboxylic acid.
| Compound Name | 7-[5-chloro-2-[3-[6-[cyclopropyl(methyl)amino]-2-methyl-4-oxo-5,6,7,8-tetrahydroquinazolin-3-yl]prop-1-ynyl]phenyl]-4-methyl-2,3,5,6,7,7a-hexahydrothieno[3,2-b]pyridin-4-ium-3-carboxylic acid |
|---|---|
| PubChem CID | 171568592 |
| Molecular Formula | C31H36ClN4O3S+ |
| Molecular Weight | 580.17 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | 7-[5-chloro-2-[3-[6-[cyclopropyl(methyl)amino]-2-methyl-4-oxo-5,6,7,8-tetrahydroquinazolin-3-yl]prop-1-ynyl]phenyl]-4-methyl-2,3,5,6,7,7a-hexahydrothieno[3,2-b]pyridin-4-ium-3-carboxylic acid |
| SMILES | Cc1nc2c(c(=O)n1CC#Cc1ccc(Cl)cc1C1CC[N+](C)=C3C(C(=O)O)CSC31)CC(N(C)C1CC1)CC2 |
| InChI | InChI=1S/C31H35ClN4O3S/c1-18-33-27-11-10-22(35(3)21-8-9-21)16-25(27)30(37)36(18)13-4-5-19-6-7-20(32)15-24(19)23-12-14-34(2)28-26(31(38)39)17-40-29(23)28/h6-7,15,21-23,26,29H,8-14,16-17H2,1-3H3/p+1 |
| InChIKey | YMTKWGBJVQQWFC-UHFFFAOYSA-O |
| XLogP | 3.60 |
| TPSA | 78.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.17 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|