C29H28ClN3O5S — CID 171568859
methyl 7-[5-chloro-2-[2-(2,8,8-trimethyl-4,6-dioxo-5,7-dihydroquinazolin-3-yl)ethoxy]phenyl]-5-methylthieno[3,2-b]pyridine-3-carboxylate (PubChem CID 171568859) has the molecular formula C29H28ClN3O5S and a molecular weight of 566.08 g/mol. Its IUPAC name is methyl 7-[5-chloro-2-[2-(2,8,8-trimethyl-4,6-dioxo-5,7-dihydroquinazolin-3-yl)ethoxy]phenyl]-5-methylthieno[3,2-b]pyridine-3-carboxylate.
| Compound Name | methyl 7-[5-chloro-2-[2-(2,8,8-trimethyl-4,6-dioxo-5,7-dihydroquinazolin-3-yl)ethoxy]phenyl]-5-methylthieno[3,2-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 171568859 |
| Molecular Formula | C29H28ClN3O5S |
| Molecular Weight | 566.08 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | methyl 7-[5-chloro-2-[2-(2,8,8-trimethyl-4,6-dioxo-5,7-dihydroquinazolin-3-yl)ethoxy]phenyl]-5-methylthieno[3,2-b]pyridine-3-carboxylate |
| SMILES | COC(=O)c1csc2c(-c3cc(Cl)ccc3OCCn3c(C)nc4c(c3=O)CC(=O)CC4(C)C)cc(C)nc12 |
| InChI | InChI=1S/C29H28ClN3O5S/c1-15-10-20(25-24(31-15)22(14-39-25)28(36)37-5)19-11-17(30)6-7-23(19)38-9-8-33-16(2)32-26-21(27(33)35)12-18(34)13-29(26,3)4/h6-7,10-11,14H,8-9,12-13H2,1-5H3 |
| InChIKey | KMLVYKVMGJQLDA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 100.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.08 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |