1-butyl-2-ethylpyrrolidin-1-ium fluoride

C10H22FN — CID 171570086

IUPAC1-butyl-2-ethylpyrrolidin-1-ium fluoride
SMILESCCCC[NH+]1CCCC1CC.[F-]
InChIInChI=1S/C10H21N.FH/c1-3-5-8-11-9-6-7-10(11)4-2;/h10H,3-9H2,1-2H3;1H
InChIKeyZYTHQQUGVDJVOZ-UHFFFAOYSA-N
MW175.29 g/mol
LogP-1.75
Rot. Bonds4

About 1-butyl-2-ethylpyrrolidin-1-ium fluoride

1-butyl-2-ethylpyrrolidin-1-ium fluoride (PubChem CID 171570086) has the molecular formula C10H22FN and a molecular weight of 175.29 g/mol. Its IUPAC name is 1-butyl-2-ethylpyrrolidin-1-ium fluoride.

Molecular Properties

Compound Name1-butyl-2-ethylpyrrolidin-1-ium fluoride
PubChem CID171570086
Molecular FormulaC10H22FN
Molecular Weight175.29 g/mol
Exact Mass175.17
IUPAC Name1-butyl-2-ethylpyrrolidin-1-ium fluoride
SMILESCCCC[NH+]1CCCC1CC.[F-]
InChIInChI=1S/C10H21N.FH/c1-3-5-8-11-9-6-7-10(11)4-2;/h10H,3-9H2,1-2H3;1H
InChIKeyZYTHQQUGVDJVOZ-UHFFFAOYSA-N
XLogP-1.75
TPSA4.44 Ų
H-Bond Donors1
H-Bond Acceptors
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500175.29
LogP ≤ 5-1.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 100

Analyze 1-butyl-2-ethylpyrrolidin-1-ium fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-butyl-2-ethylpyrrolidin-1-ium fluoride?
The IUPAC name of 1-butyl-2-ethylpyrrolidin-1-ium fluoride (CID 171570086) is 1-butyl-2-ethylpyrrolidin-1-ium fluoride.
What is the SMILES notation for 1-butyl-2-ethylpyrrolidin-1-ium fluoride?
The canonical SMILES for 1-butyl-2-ethylpyrrolidin-1-ium fluoride is CCCC[NH+]1CCCC1CC.[F-].
What is the InChIKey of 1-butyl-2-ethylpyrrolidin-1-ium fluoride?
The InChIKey is ZYTHQQUGVDJVOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N.FH/c1-3-5-8-11-9-6-7-10(11)4-2;/h10H,3-9H2,1-2H3;1H.
What are the key properties of 1-butyl-2-ethylpyrrolidin-1-ium fluoride?
1-butyl-2-ethylpyrrolidin-1-ium fluoride has a molecular weight of 175.29 g/mol, XLogP of -1.75, 4 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-ethylpyrrolidin-1-ium fluoride is sourced from PubChem (CID 171570086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).