C15H25NO2 — CID 171570105
2-ethyl-1-hexylpyridin-1-ium acetate (PubChem CID 171570105) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-ethyl-1-hexylpyridin-1-ium acetate.
| Compound Name | 2-ethyl-1-hexylpyridin-1-ium acetate |
|---|---|
| PubChem CID | 171570105 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 2-ethyl-1-hexylpyridin-1-ium acetate |
| SMILES | CC(=O)[O-].CCCCCC[n+]1ccccc1CC |
| InChI | InChI=1S/C13H22N.C2H4O2/c1-3-5-6-8-11-14-12-9-7-10-13(14)4-2;1-2(3)4/h7,9-10,12H,3-6,8,11H2,1-2H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | JKIDXNTWSDAELT-UHFFFAOYSA-M |
| XLogP | 1.87 |
| TPSA | 44.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|