2-butyl-1-methylpiperidin-1-ium chloride

C10H22ClN — CID 171571001

IUPAC2-butyl-1-methylpiperidin-1-ium chloride
SMILESCCCCC1CCCC[NH+]1C.[Cl-]
InChIInChI=1S/C10H21N.ClH/c1-3-4-7-10-8-5-6-9-11(10)2;/h10H,3-9H2,1-2H3;1H
InChIKeyAHYRVVQOFBGBJS-UHFFFAOYSA-N
MW191.75 g/mol
LogP-1.75
Rot. Bonds3

About 2-butyl-1-methylpiperidin-1-ium chloride

2-butyl-1-methylpiperidin-1-ium chloride (PubChem CID 171571001) has the molecular formula C10H22ClN and a molecular weight of 191.75 g/mol. Its IUPAC name is 2-butyl-1-methylpiperidin-1-ium chloride.

Molecular Properties

Compound Name2-butyl-1-methylpiperidin-1-ium chloride
PubChem CID171571001
Molecular FormulaC10H22ClN
Molecular Weight191.75 g/mol
Exact Mass191.14
IUPAC Name2-butyl-1-methylpiperidin-1-ium chloride
SMILESCCCCC1CCCC[NH+]1C.[Cl-]
InChIInChI=1S/C10H21N.ClH/c1-3-4-7-10-8-5-6-9-11(10)2;/h10H,3-9H2,1-2H3;1H
InChIKeyAHYRVVQOFBGBJS-UHFFFAOYSA-N
XLogP-1.75
TPSA4.44 Ų
H-Bond Donors1
H-Bond Acceptors
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.75
LogP ≤ 5-1.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 100

Analyze 2-butyl-1-methylpiperidin-1-ium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-butyl-1-methylpiperidin-1-ium chloride?
The IUPAC name of 2-butyl-1-methylpiperidin-1-ium chloride (CID 171571001) is 2-butyl-1-methylpiperidin-1-ium chloride.
What is the SMILES notation for 2-butyl-1-methylpiperidin-1-ium chloride?
The canonical SMILES for 2-butyl-1-methylpiperidin-1-ium chloride is CCCCC1CCCC[NH+]1C.[Cl-].
What is the InChIKey of 2-butyl-1-methylpiperidin-1-ium chloride?
The InChIKey is AHYRVVQOFBGBJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N.ClH/c1-3-4-7-10-8-5-6-9-11(10)2;/h10H,3-9H2,1-2H3;1H.
What are the key properties of 2-butyl-1-methylpiperidin-1-ium chloride?
2-butyl-1-methylpiperidin-1-ium chloride has a molecular weight of 191.75 g/mol, XLogP of -1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1-methylpiperidin-1-ium chloride is sourced from PubChem (CID 171571001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).