C16H24N2O3 — CID 171572082
4-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-N-methoxy-N-methylbenzamide (PubChem CID 171572082) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 4-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-N-methoxy-N-methylbenzamide.
| Compound Name | 4-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-N-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 171572082 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 4-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-N-methoxy-N-methylbenzamide |
| SMILES | CON(C)C(=O)c1ccc(CN2C[C@@H](C)O[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C16H24N2O3/c1-12-9-18(10-13(2)21-12)11-14-5-7-15(8-6-14)16(19)17(3)20-4/h5-8,12-13H,9-11H2,1-4H3/t12-,13+ |
| InChIKey | JKFPZIFNBYWWLN-BETUJISGSA-N |
| XLogP | 1.93 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|