C17H17Cl2F2N5O — CID 171572992
5-(2-aminoethoxy)-2,6-dichloro-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]pyrimidin-4-amine (PubChem CID 171572992) has the molecular formula C17H17Cl2F2N5O and a molecular weight of 416.26 g/mol. Its IUPAC name is 5-(2-aminoethoxy)-2,6-dichloro-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]pyrimidin-4-amine.
| Compound Name | 5-(2-aminoethoxy)-2,6-dichloro-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 171572992 |
| Molecular Formula | C17H17Cl2F2N5O |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 5-(2-aminoethoxy)-2,6-dichloro-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]pyrimidin-4-amine |
| SMILES | Cc1[nH]c2c(F)cc(F)cc2c1CCNc1nc(Cl)nc(Cl)c1OCCN |
| InChI | InChI=1S/C17H17Cl2F2N5O/c1-8-10(11-6-9(20)7-12(21)13(11)24-8)2-4-23-16-14(27-5-3-22)15(18)25-17(19)26-16/h6-7,24H,2-5,22H2,1H3,(H,23,25,26) |
| InChIKey | JZZWBUTZZPQANH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|