About tert-butyl N-[2-methyl-1-(2,4,6-trichloropyrimidin-5-yl)oxypropan-2-yl]carbamate
tert-butyl N-[2-methyl-1-(2,4,6-trichloropyrimidin-5-yl)oxypropan-2-yl]carbamate (PubChem CID 171573015) has the molecular formula C13H18Cl3N3O3
and a molecular weight of 370.66 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-1-(2,4,6-trichloropyrimidin-5-yl)oxypropan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-methyl-1-(2,4,6-trichloropyrimidin-5-yl)oxypropan-2-yl]carbamate |
| PubChem CID | 171573015 |
| Molecular Formula | C13H18Cl3N3O3 |
| Molecular Weight | 370.66 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | tert-butyl N-[2-methyl-1-(2,4,6-trichloropyrimidin-5-yl)oxypropan-2-yl]carbamate |
| SMILES | CC(C)(COc1c(Cl)nc(Cl)nc1Cl)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H18Cl3N3O3/c1-12(2,3)22-11(20)19-13(4,5)6-21-7-8(14)17-10(16)18-9(7)15/h6H2,1-5H3,(H,19,20) |
| InChIKey | JXEDPUARYSQQBE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.66 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[2-methyl-1-(2,4,6-trichloropyrimidin-5-yl)oxypropan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-methyl-1-(2,4,6-trichloropyrimidin-5-yl)oxypropan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[2-methyl-1-(2,4,6-trichloropyrimidin-5-yl)oxypropan-2-yl]carbamate (CID 171573015) is tert-butyl N-[2-methyl-1-(2,4,6-trichloropyrimidin-5-yl)oxypropan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[2-methyl-1-(2,4,6-trichloropyrimidin-5-yl)oxypropan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[2-methyl-1-(2,4,6-trichloropyrimidin-5-yl)oxypropan-2-yl]carbamate is CC(C)(COc1c(Cl)nc(Cl)nc1Cl)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[2-methyl-1-(2,4,6-trichloropyrimidin-5-yl)oxypropan-2-yl]carbamate?
The InChIKey is JXEDPUARYSQQBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18Cl3N3O3/c1-12(2,3)22-11(20)19-13(4,5)6-21-7-8(14)17-10(16)18-9(7)15/h6H2,1-5H3,(H,19,20).
What are the key properties of tert-butyl N-[2-methyl-1-(2,4,6-trichloropyrimidin-5-yl)oxypropan-2-yl]carbamate?
tert-butyl N-[2-methyl-1-(2,4,6-trichloropyrimidin-5-yl)oxypropan-2-yl]carbamate has a molecular weight of 370.66 g/mol, XLogP of 4.12, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-methyl-1-(2,4,6-trichloropyrimidin-5-yl)oxypropan-2-yl]carbamate is sourced from PubChem (CID 171573015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).