C22H21ClFN5O4S — CID 171573488
(3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-(cyclobutylamino)-1,3,4-oxadiazol-2-yl]-8-fluoro-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one (PubChem CID 171573488) has the molecular formula C22H21ClFN5O4S and a molecular weight of 505.96 g/mol. Its IUPAC name is (3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-(cyclobutylamino)-1,3,4-oxadiazol-2-yl]-8-fluoro-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one.
| Compound Name | (3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-(cyclobutylamino)-1,3,4-oxadiazol-2-yl]-8-fluoro-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 171573488 |
| Molecular Formula | C22H21ClFN5O4S |
| Molecular Weight | 505.96 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | (3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-(cyclobutylamino)-1,3,4-oxadiazol-2-yl]-8-fluoro-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
| SMILES | N[C@H]1CS(=O)(=O)c2cc(F)c(-c3nnc(NC4CCC4)o3)cc2N(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C22H21ClFN5O4S/c23-13-6-4-12(5-7-13)10-29-18-8-15(20-27-28-22(33-20)26-14-2-1-3-14)16(24)9-19(18)34(31,32)11-17(25)21(29)30/h4-9,14,17H,1-3,10-11,25H2,(H,26,28)/t17-/m0/s1 |
| InChIKey | AKZPXCQWYQJACI-KRWDZBQOSA-N |
| XLogP | 3.14 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.96 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |