C23H21ClF3N5O5S — CID 171573493
(3R)-3-amino-5-[(4-chlorophenyl)methyl]-1,1-dioxo-7-[5-[2-(trifluoromethyl)morpholin-4-yl]-1,3,4-oxadiazol-2-yl]-2,3-dihydro-1λ6,5-benzothiazepin-4-one (PubChem CID 171573493) has the molecular formula C23H21ClF3N5O5S and a molecular weight of 571.97 g/mol. Its IUPAC name is (3R)-3-amino-5-[(4-chlorophenyl)methyl]-1,1-dioxo-7-[5-[2-(trifluoromethyl)morpholin-4-yl]-1,3,4-oxadiazol-2-yl]-2,3-dihydro-1λ6,5-benzothiazepin-4-one.
| Compound Name | (3R)-3-amino-5-[(4-chlorophenyl)methyl]-1,1-dioxo-7-[5-[2-(trifluoromethyl)morpholin-4-yl]-1,3,4-oxadiazol-2-yl]-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 171573493 |
| Molecular Formula | C23H21ClF3N5O5S |
| Molecular Weight | 571.97 g/mol |
| Exact Mass | 571.09 |
| IUPAC Name | (3R)-3-amino-5-[(4-chlorophenyl)methyl]-1,1-dioxo-7-[5-[2-(trifluoromethyl)morpholin-4-yl]-1,3,4-oxadiazol-2-yl]-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
| SMILES | N[C@H]1CS(=O)(=O)c2ccc(-c3nnc(N4CCOC(C(F)(F)F)C4)o3)cc2N(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C23H21ClF3N5O5S/c24-15-4-1-13(2-5-15)10-32-17-9-14(3-6-18(17)38(34,35)12-16(28)21(32)33)20-29-30-22(37-20)31-7-8-36-19(11-31)23(25,26)27/h1-6,9,16,19H,7-8,10-12,28H2/t16-,19?/m0/s1 |
| InChIKey | HIANSQGFHZHCSY-UCFFOFKASA-N |
| XLogP | 2.81 |
| TPSA | 131.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.97 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |