C27H32N4O6S — CID 171573497
(3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-5-[[4-(oxan-4-yloxy)phenyl]methyl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one (PubChem CID 171573497) has the molecular formula C27H32N4O6S and a molecular weight of 540.64 g/mol. Its IUPAC name is (3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-5-[[4-(oxan-4-yloxy)phenyl]methyl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one.
| Compound Name | (3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-5-[[4-(oxan-4-yloxy)phenyl]methyl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 171573497 |
| Molecular Formula | C27H32N4O6S |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | (3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-5-[[4-(oxan-4-yloxy)phenyl]methyl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
| SMILES | CC(C)(C)c1nnc(-c2ccc3c(c2)N(Cc2ccc(OC4CCOCC4)cc2)C(=O)[C@@H](N)CS3(=O)=O)o1 |
| InChI | InChI=1S/C27H32N4O6S/c1-27(2,3)26-30-29-24(37-26)18-6-9-23-22(14-18)31(25(32)21(28)16-38(23,33)34)15-17-4-7-19(8-5-17)36-20-10-12-35-13-11-20/h4-9,14,20-21H,10-13,15-16,28H2,1-3H3/t21-/m0/s1 |
| InChIKey | JGTKYEQSGBENQZ-NRFANRHFSA-N |
| XLogP | 3.24 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |