C24H24F4N4O5S — CID 171573504
(3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-8-fluoro-1,1-dioxo-5-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2,3-dihydro-1λ6,5-benzothiazepin-4-one (PubChem CID 171573504) has the molecular formula C24H24F4N4O5S and a molecular weight of 556.54 g/mol. Its IUPAC name is (3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-8-fluoro-1,1-dioxo-5-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2,3-dihydro-1λ6,5-benzothiazepin-4-one.
| Compound Name | (3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-8-fluoro-1,1-dioxo-5-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 171573504 |
| Molecular Formula | C24H24F4N4O5S |
| Molecular Weight | 556.54 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | (3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-8-fluoro-1,1-dioxo-5-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
| SMILES | CC(C)(C)c1nnc(-c2cc3c(cc2F)S(=O)(=O)C[C@H](N)C(=O)N3Cc2ccc(OCC(F)(F)F)cc2)o1 |
| InChI | InChI=1S/C24H24F4N4O5S/c1-23(2,3)22-31-30-20(37-22)15-8-18-19(9-16(15)25)38(34,35)11-17(29)21(33)32(18)10-13-4-6-14(7-5-13)36-12-24(26,27)28/h4-9,17H,10-12,29H2,1-3H3/t17-/m0/s1 |
| InChIKey | NYTIBQPQRNNQCI-KRWDZBQOSA-N |
| XLogP | 3.76 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |