C23H22ClF2N5O4S — CID 171573506
(3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-[(3,3-difluoro-1-methylcyclobutyl)amino]-1,3,4-oxadiazol-2-yl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one (PubChem CID 171573506) has the molecular formula C23H22ClF2N5O4S and a molecular weight of 537.98 g/mol. Its IUPAC name is (3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-[(3,3-difluoro-1-methylcyclobutyl)amino]-1,3,4-oxadiazol-2-yl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one.
| Compound Name | (3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-[(3,3-difluoro-1-methylcyclobutyl)amino]-1,3,4-oxadiazol-2-yl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 171573506 |
| Molecular Formula | C23H22ClF2N5O4S |
| Molecular Weight | 537.98 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | (3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-[(3,3-difluoro-1-methylcyclobutyl)amino]-1,3,4-oxadiazol-2-yl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
| SMILES | CC1(Nc2nnc(-c3ccc4c(c3)N(Cc3ccc(Cl)cc3)C(=O)[C@@H](N)CS4(=O)=O)o2)CC(F)(F)C1 |
| InChI | InChI=1S/C23H22ClF2N5O4S/c1-22(11-23(25,26)12-22)28-21-30-29-19(35-21)14-4-7-18-17(8-14)31(9-13-2-5-15(24)6-3-13)20(32)16(27)10-36(18,33)34/h2-8,16H,9-12,27H2,1H3,(H,28,30)/t16-/m0/s1 |
| InChIKey | UMQVJEZLGDBFAU-INIZCTEOSA-N |
| XLogP | 3.64 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.98 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |