C24H23ClF2N4O4S — CID 171573521
(3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-(3,3-difluorocyclohexyl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one (PubChem CID 171573521) has the molecular formula C24H23ClF2N4O4S and a molecular weight of 536.99 g/mol. Its IUPAC name is (3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-(3,3-difluorocyclohexyl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one.
| Compound Name | (3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-(3,3-difluorocyclohexyl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 171573521 |
| Molecular Formula | C24H23ClF2N4O4S |
| Molecular Weight | 536.99 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | (3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-(3,3-difluorocyclohexyl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
| SMILES | N[C@H]1CS(=O)(=O)c2ccc(-c3nnc(C4CCCC(F)(F)C4)o3)cc2N(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C24H23ClF2N4O4S/c25-17-6-3-14(4-7-17)12-31-19-10-15(5-8-20(19)36(33,34)13-18(28)23(31)32)21-29-30-22(35-21)16-2-1-9-24(26,27)11-16/h3-8,10,16,18H,1-2,9,11-13,28H2/t16?,18-/m0/s1 |
| InChIKey | UHWVTZSJAFQDLB-DAFXYXGESA-N |
| XLogP | 4.33 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.99 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |