C25H25ClF2N4O5S — CID 171573529
(3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-(4,4-difluoro-1-methoxycyclohexyl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one (PubChem CID 171573529) has the molecular formula C25H25ClF2N4O5S and a molecular weight of 567.01 g/mol. Its IUPAC name is (3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-(4,4-difluoro-1-methoxycyclohexyl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one.
| Compound Name | (3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-(4,4-difluoro-1-methoxycyclohexyl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 171573529 |
| Molecular Formula | C25H25ClF2N4O5S |
| Molecular Weight | 567.01 g/mol |
| Exact Mass | 566.12 |
| IUPAC Name | (3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-(4,4-difluoro-1-methoxycyclohexyl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
| SMILES | COC1(c2nnc(-c3ccc4c(c3)N(Cc3ccc(Cl)cc3)C(=O)[C@@H](N)CS4(=O)=O)o2)CCC(F)(F)CC1 |
| InChI | InChI=1S/C25H25ClF2N4O5S/c1-36-24(8-10-25(27,28)11-9-24)23-31-30-21(37-23)16-4-7-20-19(12-16)32(13-15-2-5-17(26)6-3-15)22(33)18(29)14-38(20,34)35/h2-7,12,18H,8-11,13-14,29H2,1H3/t18-/m0/s1 |
| InChIKey | ZNIUBDIBUHVUOS-SFHVURJKSA-N |
| XLogP | 4.09 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.01 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |